C6H11BrO — CID 10866921
trans-(1R,2R)-2-bromocyclohexan-1-ol (PubChem CID 10866921) has the molecular formula C6H11BrO and a molecular weight of 179.06 g/mol. Its IUPAC name is trans-(1R,2R)-2-bromocyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-bromocyclohexan-1-ol |
|---|---|
| PubChem CID | 10866921 |
| Molecular Formula | C6H11BrO |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | trans-(1R,2R)-2-bromocyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1Br |
| InChI | InChI=1S/C6H11BrO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | AAMCLCZHZXKWRV-PHDIDXHHSA-N |
| XLogP | 1.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|