C11H22O2 — CID 67185134
cycloundecane-1,2-diol (PubChem CID 67185134) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is cycloundecane-1,2-diol.
| Compound Name | cycloundecane-1,2-diol |
|---|---|
| PubChem CID | 67185134 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | cycloundecane-1,2-diol |
| SMILES | OC1CCCCCCCCCC1O |
| InChI | InChI=1S/C11H22O2/c12-10-8-6-4-2-1-3-5-7-9-11(10)13/h10-13H,1-9H2 |
| InChIKey | DBNMQSKHXFTFBV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |