C12H23FO — CID 23237008
trans-(1S,2S)-2-fluorocyclododecan-1-ol (PubChem CID 23237008) has the molecular formula C12H23FO and a molecular weight of 202.31 g/mol. Its IUPAC name is trans-(1S,2S)-2-fluorocyclododecan-1-ol.
| Compound Name | trans-(1S,2S)-2-fluorocyclododecan-1-ol |
|---|---|
| PubChem CID | 23237008 |
| Molecular Formula | C12H23FO |
| Molecular Weight | 202.31 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | trans-(1S,2S)-2-fluorocyclododecan-1-ol |
| SMILES | O[C@H]1CCCCCCCCCC[C@@H]1F |
| InChI | InChI=1S/C12H23FO/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14/h11-12,14H,1-10H2/t11-,12-/m0/s1 |
| InChIKey | XYEKQVIBSUZDKS-RYUDHWBXSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |