C8H16O2 — CID 7273013
trans-(1S,2S)-cyclooctane-1,2-diol (PubChem CID 7273013) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is trans-(1S,2S)-cyclooctane-1,2-diol.
| Compound Name | trans-(1S,2S)-cyclooctane-1,2-diol |
|---|---|
| PubChem CID | 7273013 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | trans-(1S,2S)-cyclooctane-1,2-diol |
| SMILES | O[C@H]1CCCCCC[C@@H]1O |
| InChI | InChI=1S/C8H16O2/c9-7-5-3-1-2-4-6-8(7)10/h7-10H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | HUSOFJYAGDTKSK-YUMQZZPRSA-N |
| XLogP | 1.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |