About 2-chlorocyclooctan-1-ol
2-chlorocyclooctan-1-ol (PubChem CID 15084406) has the molecular formula C8H15ClO
and a molecular weight of 162.66 g/mol. Its IUPAC name is 2-chlorocyclooctan-1-ol.
Molecular Properties
| Compound Name | 2-chlorocyclooctan-1-ol |
| PubChem CID | 15084406 |
| Molecular Formula | C8H15ClO |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-chlorocyclooctan-1-ol |
| SMILES | OC1CCCCCCC1Cl |
| InChI | InChI=1S/C8H15ClO/c9-7-5-3-1-2-4-6-8(7)10/h7-8,10H,1-6H2 |
| InChIKey | LNECGGXJNNIELD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorocyclooctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorocyclooctan-1-ol?
The IUPAC name of 2-chlorocyclooctan-1-ol (CID 15084406) is 2-chlorocyclooctan-1-ol.
What is the SMILES notation for 2-chlorocyclooctan-1-ol?
The canonical SMILES for 2-chlorocyclooctan-1-ol is OC1CCCCCCC1Cl.
What is the InChIKey of 2-chlorocyclooctan-1-ol?
The InChIKey is LNECGGXJNNIELD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO/c9-7-5-3-1-2-4-6-8(7)10/h7-8,10H,1-6H2.
What are the key properties of 2-chlorocyclooctan-1-ol?
2-chlorocyclooctan-1-ol has a molecular weight of 162.66 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorocyclooctan-1-ol is sourced from PubChem (CID 15084406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).