C12H19ClO — CID 13049643
(1S,4E,8E,12R)-12-chlorocyclododeca-4,8-dien-1-ol (PubChem CID 13049643) has the molecular formula C12H19ClO and a molecular weight of 214.74 g/mol. Its IUPAC name is (1S,4E,8E,12R)-12-chlorocyclododeca-4,8-dien-1-ol.
| Compound Name | (1S,4E,8E,12R)-12-chlorocyclododeca-4,8-dien-1-ol |
|---|---|
| PubChem CID | 13049643 |
| Molecular Formula | C12H19ClO |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (1S,4E,8E,12R)-12-chlorocyclododeca-4,8-dien-1-ol |
| SMILES | O[C@H]1CC/C=C/CC/C=C/CC[C@H]1Cl |
| InChI | InChI=1S/C12H19ClO/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14/h3-6,11-12,14H,1-2,7-10H2/b5-3+,6-4+/t11-,12+/m1/s1 |
| InChIKey | ZUBTWKDVFMKNRR-NTSHVTMPSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|