About chlorosilane;3,4-dichlorocyclohexene
chlorosilane;3,4-dichlorocyclohexene (PubChem CID 173164306) has the molecular formula C6H11Cl3Si
and a molecular weight of 217.60 g/mol. Its IUPAC name is chlorosilane;3,4-dichlorocyclohexene.
Molecular Properties
| Compound Name | chlorosilane;3,4-dichlorocyclohexene |
| PubChem CID | 173164306 |
| Molecular Formula | C6H11Cl3Si |
| Molecular Weight | 217.60 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | chlorosilane;3,4-dichlorocyclohexene |
| SMILES | ClC1C=CCCC1Cl.[SiH3]Cl |
| InChI | InChI=1S/C6H8Cl2.ClH3Si/c7-5-3-1-2-4-6(5)8;1-2/h1,3,5-6H,2,4H2;2H3 |
| InChIKey | FNRMPSZNVRAHIT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chlorosilane;3,4-dichlorocyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosilane;3,4-dichlorocyclohexene?
The IUPAC name of chlorosilane;3,4-dichlorocyclohexene (CID 173164306) is chlorosilane;3,4-dichlorocyclohexene.
What is the SMILES notation for chlorosilane;3,4-dichlorocyclohexene?
The canonical SMILES for chlorosilane;3,4-dichlorocyclohexene is ClC1C=CCCC1Cl.[SiH3]Cl.
What is the InChIKey of chlorosilane;3,4-dichlorocyclohexene?
The InChIKey is FNRMPSZNVRAHIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2.ClH3Si/c7-5-3-1-2-4-6(5)8;1-2/h1,3,5-6H,2,4H2;2H3.
What are the key properties of chlorosilane;3,4-dichlorocyclohexene?
chlorosilane;3,4-dichlorocyclohexene has a molecular weight of 217.60 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosilane;3,4-dichlorocyclohexene is sourced from PubChem (CID 173164306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).