C9H17NO — CID 99130605
(1R,8S)-8-(methylamino)cyclooct-4-en-1-ol (PubChem CID 99130605) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (1R,8S)-8-(methylamino)cyclooct-4-en-1-ol.
| Compound Name | (1R,8S)-8-(methylamino)cyclooct-4-en-1-ol |
|---|---|
| PubChem CID | 99130605 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (1R,8S)-8-(methylamino)cyclooct-4-en-1-ol |
| SMILES | CN[C@H]1CCC=CCC[C@H]1O |
| InChI | InChI=1S/C9H17NO/c1-10-8-6-4-2-3-5-7-9(8)11/h2-3,8-11H,4-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | ZIPHROPQEVRVEK-DTWKUNHWSA-N |
| XLogP | 1.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|