C14H26N2O2 — CID 118458941
tert-butyl N-[(1R,4E,8S)-8-(methylamino)cyclooct-4-en-1-yl]carbamate (PubChem CID 118458941) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is tert-butyl N-[(1R,4E,8S)-8-(methylamino)cyclooct-4-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,4E,8S)-8-(methylamino)cyclooct-4-en-1-yl]carbamate |
|---|---|
| PubChem CID | 118458941 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | tert-butyl N-[(1R,4E,8S)-8-(methylamino)cyclooct-4-en-1-yl]carbamate |
| SMILES | CN[C@H]1CC/C=C\CC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-14(2,3)18-13(17)16-12-10-8-6-5-7-9-11(12)15-4/h5-6,11-12,15H,7-10H2,1-4H3,(H,16,17)/b6-5-/t11-,12+/m0/s1 |
| InChIKey | LRVPYHGKWGTWHG-ABZJQCSKSA-N |
| XLogP | 2.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|