C11H22N2O2 — CID 162423539
tert-butyl N-[(1S,2S)-2-(ethylamino)cyclobutyl]carbamate (PubChem CID 162423539) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-(ethylamino)cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-2-(ethylamino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 162423539 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-(ethylamino)cyclobutyl]carbamate |
| SMILES | CCN[C@H]1CC[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-5-12-8-6-7-9(8)13-10(14)15-11(2,3)4/h8-9,12H,5-7H2,1-4H3,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | VZWNKVPEVGIUME-IUCAKERBSA-N |
| XLogP | 1.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |