C10H20N2O4 — CID 141130030
tert-butyl N-[(2S,3S,6S)-2,6-dihydroxypiperidin-3-yl]carbamate (PubChem CID 141130030) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,6S)-2,6-dihydroxypiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,6S)-2,6-dihydroxypiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 141130030 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | tert-butyl N-[(2S,3S,6S)-2,6-dihydroxypiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](O)N[C@H]1O |
| InChI | InChI=1S/C10H20N2O4/c1-10(2,3)16-9(15)11-6-4-5-7(13)12-8(6)14/h6-8,12-14H,4-5H2,1-3H3,(H,11,15)/t6-,7-,8-/m0/s1 |
| InChIKey | LLDQPHPNDNQWDR-FXQIFTODSA-N |
| XLogP | -0.10 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |