C7H16N2O — CID 67311955
(3R,4R)-1-methyl-4-(methylamino)piperidin-3-ol (PubChem CID 67311955) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is (3R,4R)-1-methyl-4-(methylamino)piperidin-3-ol.
| Compound Name | (3R,4R)-1-methyl-4-(methylamino)piperidin-3-ol |
|---|---|
| PubChem CID | 67311955 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | (3R,4R)-1-methyl-4-(methylamino)piperidin-3-ol |
| SMILES | CN[C@@H]1CCN(C)C[C@H]1O |
| InChI | InChI=1S/C7H16N2O/c1-8-6-3-4-9(2)5-7(6)10/h6-8,10H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | LNOVKJXZYDPSRH-RNFRBKRXSA-N |
| XLogP | -0.73 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |