C6H12N4O — CID 149434787
(3R,4R)-4-azido-1-methylpiperidin-3-ol (PubChem CID 149434787) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is (3R,4R)-4-azido-1-methylpiperidin-3-ol.
| Compound Name | (3R,4R)-4-azido-1-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 149434787 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (3R,4R)-4-azido-1-methylpiperidin-3-ol |
| SMILES | CN1CC[C@@H](N=[N+]=[N-])[C@H](O)C1 |
| InChI | InChI=1S/C6H12N4O/c1-10-3-2-5(8-9-7)6(11)4-10/h5-6,11H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | NMUVVDUJRJZXKH-PHDIDXHHSA-N |
| XLogP | 0.36 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|