C6H10N6O2 — CID 131137989
(1S,2S,4S,5S)-2,5-diazidocyclohexane-1,4-diol (PubChem CID 131137989) has the molecular formula C6H10N6O2 and a molecular weight of 198.19 g/mol. Its IUPAC name is (1S,2S,4S,5S)-2,5-diazidocyclohexane-1,4-diol.
| Compound Name | (1S,2S,4S,5S)-2,5-diazidocyclohexane-1,4-diol |
|---|---|
| PubChem CID | 131137989 |
| Molecular Formula | C6H10N6O2 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1S,2S,4S,5S)-2,5-diazidocyclohexane-1,4-diol |
| SMILES | [N-]=[N+]=N[C@H]1C[C@H](O)[C@@H](N=[N+]=[N-])C[C@@H]1O |
| InChI | InChI=1S/C6H10N6O2/c7-11-9-3-1-5(13)4(10-12-8)2-6(3)14/h3-6,13-14H,1-2H2/t3-,4-,5-,6-/m0/s1 |
| InChIKey | LTERTUYKFMDNRX-BXKVDMCESA-N |
| XLogP | 0.86 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|