C9H17N3O2 — CID 11106344
(1R,2S,3R,5R)-3-azido-5-propan-2-ylcyclohexane-1,2-diol (PubChem CID 11106344) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-azido-5-propan-2-ylcyclohexane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-azido-5-propan-2-ylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 11106344 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (1R,2S,3R,5R)-3-azido-5-propan-2-ylcyclohexane-1,2-diol |
| SMILES | CC(C)[C@H]1C[C@@H](O)[C@@H](O)[C@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C9H17N3O2/c1-5(2)6-3-7(11-12-10)9(14)8(13)4-6/h5-9,13-14H,3-4H2,1-2H3/t6-,7-,8-,9+/m1/s1 |
| InChIKey | BDYWVUQEYQSNBH-BGZDPUMWSA-N |
| XLogP | 1.45 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|