C6H11N3O2 — CID 13427856
(1R,2S,3R)-3-azidocyclohexane-1,2-diol (PubChem CID 13427856) has the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. Its IUPAC name is (1R,2S,3R)-3-azidocyclohexane-1,2-diol.
| Compound Name | (1R,2S,3R)-3-azidocyclohexane-1,2-diol |
|---|---|
| PubChem CID | 13427856 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (1R,2S,3R)-3-azidocyclohexane-1,2-diol |
| SMILES | [N-]=[N+]=N[C@@H]1CCC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H11N3O2/c7-9-8-4-2-1-3-5(10)6(4)11/h4-6,10-11H,1-3H2/t4-,5-,6+/m1/s1 |
| InChIKey | BYJLFVCKKHKGQZ-PBXRRBTRSA-N |
| XLogP | 0.57 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|