C6H11F2N3O — CID 167634886
cis-(1R,2S)-2-azidocyclohexan-1-ol;molecular fluorine (PubChem CID 167634886) has the molecular formula C6H11F2N3O and a molecular weight of 179.17 g/mol. Its IUPAC name is cis-(1R,2S)-2-azidocyclohexan-1-ol;molecular fluorine.
| Compound Name | cis-(1R,2S)-2-azidocyclohexan-1-ol;molecular fluorine |
|---|---|
| PubChem CID | 167634886 |
| Molecular Formula | C6H11F2N3O |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | cis-(1R,2S)-2-azidocyclohexan-1-ol;molecular fluorine |
| SMILES | FF.[N-]=[N+]=N[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C6H11N3O.F2/c7-9-8-5-3-1-2-4-6(5)10;1-2/h5-6,10H,1-4H2;/t5-,6+;/m0./s1 |
| InChIKey | OIHIVOFGJVATMN-RIHPBJNCSA-N |
| XLogP | 2.44 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|