C18H16F2N4O — CID 134238529
trans-(1S,6R)-2-azido-6-(3,6-difluorocarbazol-9-yl)cyclohexan-1-ol (PubChem CID 134238529) has the molecular formula C18H16F2N4O and a molecular weight of 342.35 g/mol. Its IUPAC name is trans-(1S,6R)-2-azido-6-(3,6-difluorocarbazol-9-yl)cyclohexan-1-ol.
| Compound Name | trans-(1S,6R)-2-azido-6-(3,6-difluorocarbazol-9-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 134238529 |
| Molecular Formula | C18H16F2N4O |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | trans-(1S,6R)-2-azido-6-(3,6-difluorocarbazol-9-yl)cyclohexan-1-ol |
| SMILES | [N-]=[N+]=NC1CCC[C@@H](n2c3ccc(F)cc3c3cc(F)ccc32)[C@@H]1O |
| InChI | InChI=1S/C18H16F2N4O/c19-10-4-6-15-12(8-10)13-9-11(20)5-7-16(13)24(15)17-3-1-2-14(18(17)25)22-23-21/h4-9,14,17-18,25H,1-3H2/t14?,17-,18-/m1/s1 |
| InChIKey | RXKXLZDVAMGPAT-KNHHTTPFSA-N |
| XLogP | 4.84 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|