About (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol
(3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol (PubChem CID 76901758) has the molecular formula C17H16F2N2O
and a molecular weight of 302.32 g/mol. Its IUPAC name is (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol.
Molecular Properties
| Compound Name | (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol |
| PubChem CID | 76901758 |
| Molecular Formula | C17H16F2N2O |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol |
| SMILES | O[C@@H]1CNCC[C@H]1n1c2ccc(F)cc2c2cc(F)ccc21 |
| InChI | InChI=1S/C17H16F2N2O/c18-10-1-3-14-12(7-10)13-8-11(19)2-4-15(13)21(14)16-5-6-20-9-17(16)22/h1-4,7-8,16-17,20,22H,5-6,9H2/t16-,17-/m1/s1 |
| InChIKey | HFPMVXXSWSYUEA-IAGOWNOFSA-N |
| XLogP | 2.97 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol?
The IUPAC name of (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol (CID 76901758) is (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol.
What is the SMILES notation for (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol?
The canonical SMILES for (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol is O[C@@H]1CNCC[C@H]1n1c2ccc(F)cc2c2cc(F)ccc21.
What is the InChIKey of (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol?
The InChIKey is HFPMVXXSWSYUEA-IAGOWNOFSA-N. The full InChI is InChI=1S/C17H16F2N2O/c18-10-1-3-14-12(7-10)13-8-11(19)2-4-15(13)21(14)16-5-6-20-9-17(16)22/h1-4,7-8,16-17,20,22H,5-6,9H2/t16-,17-/m1/s1.
What are the key properties of (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol?
(3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol has a molecular weight of 302.32 g/mol, XLogP of 2.97, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol is sourced from PubChem (CID 76901758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).