C24H22F2N2O — CID 118595150
(3R)-1-benzyl-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol (PubChem CID 118595150) has the molecular formula C24H22F2N2O and a molecular weight of 392.45 g/mol. Its IUPAC name is (3R)-1-benzyl-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol.
| Compound Name | (3R)-1-benzyl-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 118595150 |
| Molecular Formula | C24H22F2N2O |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (3R)-1-benzyl-4-(3,6-difluorocarbazol-9-yl)piperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)CCC1n1c2ccc(F)cc2c2cc(F)ccc21 |
| InChI | InChI=1S/C24H22F2N2O/c25-17-6-8-21-19(12-17)20-13-18(26)7-9-22(20)28(21)23-10-11-27(15-24(23)29)14-16-4-2-1-3-5-16/h1-9,12-13,23-24,29H,10-11,14-15H2/t23?,24-/m1/s1 |
| InChIKey | KLUXHGIKMRQTOQ-XMMISQBUSA-N |
| XLogP | 4.88 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |