C21H26N2O — CID 156503157
(3R,4R)-1-benzyl-4-(3,4-dihydro-1H-isoquinolin-2-yl)piperidin-3-ol (PubChem CID 156503157) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-(3,4-dihydro-1H-isoquinolin-2-yl)piperidin-3-ol.
| Compound Name | (3R,4R)-1-benzyl-4-(3,4-dihydro-1H-isoquinolin-2-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 156503157 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3R,4R)-1-benzyl-4-(3,4-dihydro-1H-isoquinolin-2-yl)piperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)CC[C@H]1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H26N2O/c24-21-16-22(14-17-6-2-1-3-7-17)12-11-20(21)23-13-10-18-8-4-5-9-19(18)15-23/h1-9,20-21,24H,10-16H2/t20-,21-/m1/s1 |
| InChIKey | VUYDKUCWJAPXMM-NHCUHLMSSA-N |
| XLogP | 2.68 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |