C23H29BrN2O — CID 10410357
(3R,4R)-1-[(4-bromophenyl)methyl]-4-(4-phenylpiperidin-1-yl)piperidin-3-ol (PubChem CID 10410357) has the molecular formula C23H29BrN2O and a molecular weight of 429.40 g/mol. Its IUPAC name is (3R,4R)-1-[(4-bromophenyl)methyl]-4-(4-phenylpiperidin-1-yl)piperidin-3-ol.
| Compound Name | (3R,4R)-1-[(4-bromophenyl)methyl]-4-(4-phenylpiperidin-1-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 10410357 |
| Molecular Formula | C23H29BrN2O |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (3R,4R)-1-[(4-bromophenyl)methyl]-4-(4-phenylpiperidin-1-yl)piperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2ccc(Br)cc2)CC[C@H]1N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29BrN2O/c24-21-8-6-18(7-9-21)16-25-13-12-22(23(27)17-25)26-14-10-20(11-15-26)19-4-2-1-3-5-19/h1-9,20,22-23,27H,10-17H2/t22-,23-/m1/s1 |
| InChIKey | UFYZTEDPKSXMMC-DHIUTWEWSA-N |
| XLogP | 4.26 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |