C23H31Cl2IN2O — CID 52949024
(3R,4R)-1-[(3-iodophenyl)methyl]-3-(4-phenylpiperidin-1-yl)piperidin-4-ol;dihydrochloride (PubChem CID 52949024) has the molecular formula C23H31Cl2IN2O and a molecular weight of 549.32 g/mol. Its IUPAC name is (3R,4R)-1-[(3-iodophenyl)methyl]-3-(4-phenylpiperidin-1-yl)piperidin-4-ol;dihydrochloride.
| Compound Name | (3R,4R)-1-[(3-iodophenyl)methyl]-3-(4-phenylpiperidin-1-yl)piperidin-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 52949024 |
| Molecular Formula | C23H31Cl2IN2O |
| Molecular Weight | 549.32 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | (3R,4R)-1-[(3-iodophenyl)methyl]-3-(4-phenylpiperidin-1-yl)piperidin-4-ol;dihydrochloride |
| SMILES | Cl.Cl.O[C@@H]1CCN(Cc2cccc(I)c2)C[C@H]1N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29IN2O.2ClH/c24-21-8-4-5-18(15-21)16-25-12-11-23(27)22(17-25)26-13-9-20(10-14-26)19-6-2-1-3-7-19;;/h1-8,15,20,22-23,27H,9-14,16-17H2;2*1H/t22-,23-;;/m1../s1 |
| InChIKey | GUAHBLYHKWROPG-TVLOEWINSA-N |
| XLogP | 4.95 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|