C22H27IN2O — CID 56669479
(3R,4R)-1-(3-iodophenyl)-3-(4-phenylpiperidin-1-yl)piperidin-4-ol (PubChem CID 56669479) has the molecular formula C22H27IN2O and a molecular weight of 462.38 g/mol. Its IUPAC name is (3R,4R)-1-(3-iodophenyl)-3-(4-phenylpiperidin-1-yl)piperidin-4-ol.
| Compound Name | (3R,4R)-1-(3-iodophenyl)-3-(4-phenylpiperidin-1-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 56669479 |
| Molecular Formula | C22H27IN2O |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (3R,4R)-1-(3-iodophenyl)-3-(4-phenylpiperidin-1-yl)piperidin-4-ol |
| SMILES | O[C@@H]1CCN(c2cccc(I)c2)C[C@H]1N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27IN2O/c23-19-7-4-8-20(15-19)25-14-11-22(26)21(16-25)24-12-9-18(10-13-24)17-5-2-1-3-6-17/h1-8,15,18,21-22,26H,9-14,16H2/t21-,22-/m1/s1 |
| InChIKey | XICAKLOQVWILJT-FGZHOGPDSA-N |
| XLogP | 4.11 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|