C21H24INO — CID 22841922
(2S,3S)-8-iodo-3-(4-phenylpiperidin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 22841922) has the molecular formula C21H24INO and a molecular weight of 433.33 g/mol. Its IUPAC name is (2S,3S)-8-iodo-3-(4-phenylpiperidin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2S,3S)-8-iodo-3-(4-phenylpiperidin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 22841922 |
| Molecular Formula | C21H24INO |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (2S,3S)-8-iodo-3-(4-phenylpiperidin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | O[C@H]1Cc2c(I)cccc2C[C@@H]1N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24INO/c22-19-8-4-7-17-13-20(21(24)14-18(17)19)23-11-9-16(10-12-23)15-5-2-1-3-6-15/h1-8,16,20-21,24H,9-14H2/t20-,21-/m0/s1 |
| InChIKey | WHSCBBDEYZHIOG-SFTDATJTSA-N |
| XLogP | 4.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|