C21H26N2 — CID 102020253
4-phenyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]piperidine (PubChem CID 102020253) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 4-phenyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]piperidine.
| Compound Name | 4-phenyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]piperidine |
|---|---|
| PubChem CID | 102020253 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 4-phenyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]piperidine |
| SMILES | c1ccc(C2CCN([C@@H]3CNC[C@H]3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H26N2/c1-3-7-17(8-4-1)18-11-13-23(14-12-18)21-16-22-15-20(21)19-9-5-2-6-10-19/h1-10,18,20-22H,11-16H2/t20-,21+/m0/s1 |
| InChIKey | SCFWYVWRHOYJPW-LEWJYISDSA-N |
| XLogP | 3.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |