C27H30N2 — CID 102020251
1-[(3S,4R)-1,4-diphenylpyrrolidin-3-yl]-4-phenylpiperidine (PubChem CID 102020251) has the molecular formula C27H30N2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-[(3S,4R)-1,4-diphenylpyrrolidin-3-yl]-4-phenylpiperidine.
| Compound Name | 1-[(3S,4R)-1,4-diphenylpyrrolidin-3-yl]-4-phenylpiperidine |
|---|---|
| PubChem CID | 102020251 |
| Molecular Formula | C27H30N2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-[(3S,4R)-1,4-diphenylpyrrolidin-3-yl]-4-phenylpiperidine |
| SMILES | c1ccc(C2CCN([C@@H]3CN(c4ccccc4)C[C@H]3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H30N2/c1-4-10-22(11-5-1)23-16-18-28(19-17-23)27-21-29(25-14-8-3-9-15-25)20-26(27)24-12-6-2-7-13-24/h1-15,23,26-27H,16-21H2/t26-,27+/m0/s1 |
| InChIKey | MPJKQGXRNMWXDH-RRPNLBNLSA-N |
| XLogP | 5.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |