(3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid

C17H17NO2 — CID 162471093

IUPAC(3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@@H]1CN(c2ccccc2)C[C@H]1c1ccccc1
InChIInChI=1S/C17H17NO2/c19-17(20)16-12-18(14-9-5-2-6-10-14)11-15(16)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2,(H,19,20)/t15-,16+/m0/s1
InChIKeyKRCIQCMLHPKHLR-JKSUJKDBSA-N
MW267.33 g/mol
LogP2.99
Rot. Bonds3

About (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid

(3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid (PubChem CID 162471093) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name(3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid
PubChem CID162471093
Molecular FormulaC17H17NO2
Molecular Weight267.33 g/mol
Exact Mass267.13
IUPAC Name(3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@@H]1CN(c2ccccc2)C[C@H]1c1ccccc1
InChIInChI=1S/C17H17NO2/c19-17(20)16-12-18(14-9-5-2-6-10-14)11-15(16)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2,(H,19,20)/t15-,16+/m0/s1
InChIKeyKRCIQCMLHPKHLR-JKSUJKDBSA-N
XLogP2.99
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.33
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid?
The IUPAC name of (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid (CID 162471093) is (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid?
The canonical SMILES for (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid is O=C(O)[C@@H]1CN(c2ccccc2)C[C@H]1c1ccccc1.
What is the InChIKey of (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid?
The InChIKey is KRCIQCMLHPKHLR-JKSUJKDBSA-N. The full InChI is InChI=1S/C17H17NO2/c19-17(20)16-12-18(14-9-5-2-6-10-14)11-15(16)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2,(H,19,20)/t15-,16+/m0/s1.
What are the key properties of (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid?
(3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid has a molecular weight of 267.33 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1,4-diphenylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 162471093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).