C16H21NO3 — CID 166790395
(3R,4S)-1-(oxan-4-yl)-4-phenylpyrrolidine-3-carboxylic acid (PubChem CID 166790395) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (3R,4S)-1-(oxan-4-yl)-4-phenylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-1-(oxan-4-yl)-4-phenylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166790395 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (3R,4S)-1-(oxan-4-yl)-4-phenylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C2CCOCC2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c18-16(19)15-11-17(13-6-8-20-9-7-13)10-14(15)12-4-2-1-3-5-12/h1-5,13-15H,6-11H2,(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | OTAKGVTUUSBJJK-CABCVRRESA-N |
| XLogP | 1.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |