C15H20N2O3 — CID 72939902
(3S,4R)-1-(oxan-4-yl)-4-pyridin-4-ylpyrrolidine-3-carboxylic acid (PubChem CID 72939902) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (3S,4R)-1-(oxan-4-yl)-4-pyridin-4-ylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4R)-1-(oxan-4-yl)-4-pyridin-4-ylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72939902 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (3S,4R)-1-(oxan-4-yl)-4-pyridin-4-ylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C2CCOCC2)C[C@H]1c1ccncc1 |
| InChI | InChI=1S/C15H20N2O3/c18-15(19)14-10-17(12-3-7-20-8-4-12)9-13(14)11-1-5-16-6-2-11/h1-2,5-6,12-14H,3-4,7-10H2,(H,18,19)/t13-,14+/m0/s1 |
| InChIKey | YTZGZJFGUSMVCF-UONOGXRCSA-N |
| XLogP | 1.36 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |