C18H19NO2 — CID 12922299
(3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid (PubChem CID 12922299) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 12922299 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(Cc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c20-18(21)17-13-19(11-14-7-3-1-4-8-14)12-16(17)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2,(H,20,21)/t16-,17+/m0/s1 |
| InChIKey | IMROELKPEBZHGE-DLBZAZTESA-N |
| XLogP | 2.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |