C20H24IN3O2 — CID 142041182
3-[4-(5-amino-2-hydroxyphenyl)piperazin-1-yl]-5-iodo-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 142041182) has the molecular formula C20H24IN3O2 and a molecular weight of 465.34 g/mol. Its IUPAC name is 3-[4-(5-amino-2-hydroxyphenyl)piperazin-1-yl]-5-iodo-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 3-[4-(5-amino-2-hydroxyphenyl)piperazin-1-yl]-5-iodo-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 142041182 |
| Molecular Formula | C20H24IN3O2 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 3-[4-(5-amino-2-hydroxyphenyl)piperazin-1-yl]-5-iodo-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | Nc1ccc(O)c(N2CCN(C3Cc4c(I)cccc4CC3O)CC2)c1 |
| InChI | InChI=1S/C20H24IN3O2/c21-16-3-1-2-13-10-20(26)18(12-15(13)16)24-8-6-23(7-9-24)17-11-14(22)4-5-19(17)25/h1-5,11,18,20,25-26H,6-10,12,22H2 |
| InChIKey | WYMFRJXFNQNFLL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|