C21H27N3O — CID 70123323
(2S,3S)-5-amino-3-[4-(2-methylphenyl)piperazin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 70123323) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is (2S,3S)-5-amino-3-[4-(2-methylphenyl)piperazin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2S,3S)-5-amino-3-[4-(2-methylphenyl)piperazin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 70123323 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (2S,3S)-5-amino-3-[4-(2-methylphenyl)piperazin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | Cc1ccccc1N1CCN(C2Cc3c(N)cccc3C[C@@H]2O)CC1 |
| InChI | InChI=1S/C21H27N3O/c1-15-5-2-3-8-19(15)23-9-11-24(12-10-23)20-14-17-16(13-21(20)25)6-4-7-18(17)22/h2-8,20-21,25H,9-14,22H2,1H3/t20?,21-/m0/s1 |
| InChIKey | ZIBIKWQRMUEOPV-LBAQZLPGSA-N |
| XLogP | 2.23 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|