C11H15NO2 — CID 58734131
(2R,3R)-5-amino-3-methoxy-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 58734131) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (2R,3R)-5-amino-3-methoxy-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2R,3R)-5-amino-3-methoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 58734131 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2R,3R)-5-amino-3-methoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | CO[C@@H]1Cc2c(N)cccc2C[C@H]1O |
| InChI | InChI=1S/C11H15NO2/c1-14-11-6-8-7(5-10(11)13)3-2-4-9(8)12/h2-4,10-11,13H,5-6,12H2,1H3/t10-,11-/m1/s1 |
| InChIKey | BCFDLOLFWHEEFX-GHMZBOCLSA-N |
| XLogP | 0.74 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|