C21H27N3O2 — CID 139061206
(2R,3R)-5-amino-3-[4-(3-methoxyphenyl)piperazin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 139061206) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (2R,3R)-5-amino-3-[4-(3-methoxyphenyl)piperazin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2R,3R)-5-amino-3-[4-(3-methoxyphenyl)piperazin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 139061206 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (2R,3R)-5-amino-3-[4-(3-methoxyphenyl)piperazin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | COc1cccc(N2CCN([C@@H]3Cc4c(N)cccc4C[C@H]3O)CC2)c1 |
| InChI | InChI=1S/C21H27N3O2/c1-26-17-6-3-5-16(13-17)23-8-10-24(11-9-23)20-14-18-15(12-21(20)25)4-2-7-19(18)22/h2-7,13,20-21,25H,8-12,14,22H2,1H3/t20-,21-/m1/s1 |
| InChIKey | PCXMHXFSBISIAG-NHCUHLMSSA-N |
| XLogP | 1.93 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|