C32H51N3OSn — CID 70121804
(2R,3R)-3-[4-(2-aminophenyl)piperazin-1-yl]-5-tributylstannyl-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 70121804) has the molecular formula C32H51N3OSn and a molecular weight of 612.49 g/mol. Its IUPAC name is (2R,3R)-3-[4-(2-aminophenyl)piperazin-1-yl]-5-tributylstannyl-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2R,3R)-3-[4-(2-aminophenyl)piperazin-1-yl]-5-tributylstannyl-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 70121804 |
| Molecular Formula | C32H51N3OSn |
| Molecular Weight | 612.49 g/mol |
| Exact Mass | 613.31 |
| IUPAC Name | (2R,3R)-3-[4-(2-aminophenyl)piperazin-1-yl]-5-tributylstannyl-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc2c1CC(N1CCN(c3ccccc3N)CC1)[C@H](O)C2 |
| InChI | InChI=1S/C20H24N3O.3C4H9.Sn/c21-17-7-3-4-8-18(17)22-9-11-23(12-10-22)19-13-15-5-1-2-6-16(15)14-20(19)24;3*1-3-4-2;/h1-4,6-8,19-20,24H,9-14,21H2;3*1,3-4H2,2H3;/t19?,20-;;;;/m1..../s1 |
| InChIKey | QQMINRRVWIXVGL-QLDNZOTGSA-N |
| XLogP | 5.98 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|