C15H24N2 — CID 43370261
2-heptyl-1,3-dihydroisoindol-4-amine (PubChem CID 43370261) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-heptyl-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-heptyl-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 43370261 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-heptyl-1,3-dihydroisoindol-4-amine |
| SMILES | CCCCCCCN1Cc2cccc(N)c2C1 |
| InChI | InChI=1S/C15H24N2/c1-2-3-4-5-6-10-17-11-13-8-7-9-15(16)14(13)12-17/h7-9H,2-6,10-12,16H2,1H3 |
| InChIKey | NNOSLWFFMKFPJF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|