C18H22BrN — CID 141349765
6-bromo-2-hexyl-1,3-dihydrobenzo[de]isoquinoline (PubChem CID 141349765) has the molecular formula C18H22BrN and a molecular weight of 332.29 g/mol. Its IUPAC name is 6-bromo-2-hexyl-1,3-dihydrobenzo[de]isoquinoline.
| Compound Name | 6-bromo-2-hexyl-1,3-dihydrobenzo[de]isoquinoline |
|---|---|
| PubChem CID | 141349765 |
| Molecular Formula | C18H22BrN |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 6-bromo-2-hexyl-1,3-dihydrobenzo[de]isoquinoline |
| SMILES | CCCCCCN1Cc2cccc3c(Br)ccc(c23)C1 |
| InChI | InChI=1S/C18H22BrN/c1-2-3-4-5-11-20-12-14-7-6-8-16-17(19)10-9-15(13-20)18(14)16/h6-10H,2-5,11-13H2,1H3 |
| InChIKey | VTCVHJJIYVWQCT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|