C21H25IN2O — CID 10575440
(2R,3R)-8-amino-3-[4-(4-iodophenyl)piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 10575440) has the molecular formula C21H25IN2O and a molecular weight of 448.35 g/mol. Its IUPAC name is (2R,3R)-8-amino-3-[4-(4-iodophenyl)piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2R,3R)-8-amino-3-[4-(4-iodophenyl)piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 10575440 |
| Molecular Formula | C21H25IN2O |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (2R,3R)-8-amino-3-[4-(4-iodophenyl)piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | Nc1cccc2c1C[C@@H](O)[C@H](N1CCC(c3ccc(I)cc3)CC1)C2 |
| InChI | InChI=1S/C21H25IN2O/c22-17-6-4-14(5-7-17)15-8-10-24(11-9-15)20-12-16-2-1-3-19(23)18(16)13-21(20)25/h1-7,15,20-21,25H,8-13,23H2/t20-,21-/m1/s1 |
| InChIKey | KVUWKIGZGXPSCX-NHCUHLMSSA-N |
| XLogP | 3.58 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|