C11H14O3 — CID 123352888
5-methoxy-1,2,3,4-tetrahydronaphthalene-2,3-diol (PubChem CID 123352888) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-methoxy-1,2,3,4-tetrahydronaphthalene-2,3-diol.
| Compound Name | 5-methoxy-1,2,3,4-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 123352888 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-methoxy-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| SMILES | COc1cccc2c1CC(O)C(O)C2 |
| InChI | InChI=1S/C11H14O3/c1-14-11-4-2-3-7-5-9(12)10(13)6-8(7)11/h2-4,9-10,12-13H,5-6H2,1H3 |
| InChIKey | MSYCVDFPXWURSN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |