About (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene
(2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 67639312) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene.
Analyze (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene?
The IUPAC name of (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene (CID 67639312) is (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene.
What is the SMILES notation for (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene?
The canonical SMILES for (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene is COc1cccc2c1C[C@@H](C)CC2.
What is the InChIKey of (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene?
The InChIKey is MSYQJKLOSYUPIE-VIFPVBQESA-N. The full InChI is InChI=1S/C12H16O/c1-9-6-7-10-4-3-5-12(13-2)11(10)8-9/h3-5,9H,6-8H2,1-2H3/t9-/m0/s1.
What are the key properties of (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene?
(2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene has a molecular weight of 176.26 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-8-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalene is sourced from PubChem (CID 67639312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).