C11H13Br — CID 142027727
(2R)-8-bromo-2-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 142027727) has the molecular formula C11H13Br and a molecular weight of 225.13 g/mol. Its IUPAC name is (2R)-8-bromo-2-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (2R)-8-bromo-2-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 142027727 |
| Molecular Formula | C11H13Br |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | (2R)-8-bromo-2-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C[C@@H]1CCc2cccc(Br)c2C1 |
| InChI | InChI=1S/C11H13Br/c1-8-5-6-9-3-2-4-11(12)10(9)7-8/h2-4,8H,5-7H2,1H3/t8-/m1/s1 |
| InChIKey | HVCIUANTNDEQAM-MRVPVSSYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |