C11H16BrN — CID 143708719
8-bromo-1,2,3,4-tetrahydroisoquinoline;ethane (PubChem CID 143708719) has the molecular formula C11H16BrN and a molecular weight of 242.16 g/mol. Its IUPAC name is 8-bromo-1,2,3,4-tetrahydroisoquinoline;ethane.
| Compound Name | 8-bromo-1,2,3,4-tetrahydroisoquinoline;ethane |
|---|---|
| PubChem CID | 143708719 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 8-bromo-1,2,3,4-tetrahydroisoquinoline;ethane |
| SMILES | Brc1cccc2c1CNCC2.CC |
| InChI | InChI=1S/C9H10BrN.C2H6/c10-9-3-1-2-7-4-5-11-6-8(7)9;1-2/h1-3,11H,4-6H2;1-2H3 |
| InChIKey | BELDGPJYTUJUFJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |