C15H25NOSi — CID 167736770
tert-butyl-dimethyl-(1,2,3,4-tetrahydroisoquinolin-8-yloxy)silane (PubChem CID 167736770) has the molecular formula C15H25NOSi and a molecular weight of 263.46 g/mol. Its IUPAC name is tert-butyl-dimethyl-(1,2,3,4-tetrahydroisoquinolin-8-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(1,2,3,4-tetrahydroisoquinolin-8-yloxy)silane |
|---|---|
| PubChem CID | 167736770 |
| Molecular Formula | C15H25NOSi |
| Molecular Weight | 263.46 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | tert-butyl-dimethyl-(1,2,3,4-tetrahydroisoquinolin-8-yloxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc2c1CNCC2 |
| InChI | InChI=1S/C15H25NOSi/c1-15(2,3)18(4,5)17-14-8-6-7-12-9-10-16-11-13(12)14/h6-8,16H,9-11H2,1-5H3 |
| InChIKey | BYPPVNANOZLUJH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|