C11H16BrNO — CID 20602
2-ethyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-ol bromide (PubChem CID 20602) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is 2-ethyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-ol bromide.
| Compound Name | 2-ethyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-ol bromide |
|---|---|
| PubChem CID | 20602 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-ethyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-ol bromide |
| SMILES | CC[NH+]1CCc2c(O)cccc2C1.[Br-] |
| InChI | InChI=1S/C11H15NO.BrH/c1-2-12-7-6-10-9(8-12)4-3-5-11(10)13;/h3-5,13H,2,6-8H2,1H3;1H |
| InChIKey | HHXJQWUXHSIFMY-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |