C9H11NO2 — CID 36937
6,7-Dihydroxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 36937) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 6,7-Dihydroxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 36937 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | C1CNCC2=CC(=C(C=C21)O)O |
| InChI | InChI=1S/C9H11NO2/c11-8-3-6-1-2-10-5-7(6)4-9(8)12/h3-4,10-12H,1-2,5H2 |
| InChIKey | MBFUSGLXKQWVDW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | 163 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|