C11H15NO2 — CID 15623
6,7-Dimethoxy-1,2,3,4-Tetrahydroisoquinoline (PubChem CID 15623) has the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. Its IUPAC name is 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6,7-Dimethoxy-1,2,3,4-Tetrahydroisoquinoline |
|---|---|
| PubChem CID | 15623 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COC1=C(C=C2CNCCC2=C1)OC |
| InChI | InChI=1S/C11H15NO2/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2/h5-6,12H,3-4,7H2,1-2H3 |
| InChIKey | CEIXWJHURKEBMQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 30.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 186 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |