About Salsolidine
Salsolidine (PubChem CID 164752) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is (1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | Salsolidine |
| PubChem CID | 164752 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C[C@H]1C2=CC(=C(C=C2CCN1)OC)OC |
| InChI | InChI=1S/C12H17NO2/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8/h6-8,13H,4-5H2,1-3H3/t8-/m0/s1 |
| InChIKey | HMYJLVDKPJHJCF-QMMMGPOBSA-N |
| XLogP | 1.70 |
| TPSA | 30.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 210 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Salsolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Salsolidine?
The IUPAC name of Salsolidine (CID 164752) is (1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline.
What is the SMILES notation for Salsolidine?
The canonical SMILES for Salsolidine is C[C@H]1C2=CC(=C(C=C2CCN1)OC)OC.
What is the InChIKey of Salsolidine?
The InChIKey is HMYJLVDKPJHJCF-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H17NO2/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8/h6-8,13H,4-5H2,1-3H3/t8-/m0/s1.
What are the key properties of Salsolidine?
Salsolidine has a molecular weight of 207.27 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Salsolidine is sourced from PubChem (CID 164752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).