About 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline
6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline (PubChem CID 27694) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline.
Analyze 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline?
The IUPAC name of 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline (CID 27694) is 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline?
The canonical SMILES for 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline is CN1CCC2=CC(=C(C=C2C1)OC)OC.
What is the InChIKey of 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline?
The InChIKey is TXPPKWZEHFNZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-13-5-4-9-6-11(14-2)12(15-3)7-10(9)8-13/h6-7H,4-5,8H2,1-3H3.
What are the key properties of 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline?
6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline has a molecular weight of 207.27 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinoline is sourced from PubChem (CID 27694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).