C12H17NO2 — CID 27694
6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 27694) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 27694 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(C)CC2 |
| InChI | InChI=1S/C12H17NO2/c1-13-5-4-9-6-11(14-2)12(15-3)7-10(9)8-13/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | TXPPKWZEHFNZOE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |