C13H16 — CID 177206277
5-ethenyl-2-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 177206277) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 5-ethenyl-2-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-ethenyl-2-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 177206277 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 5-ethenyl-2-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=Cc1cccc2c1CCC(C)C2 |
| InChI | InChI=1S/C13H16/c1-3-11-5-4-6-12-9-10(2)7-8-13(11)12/h3-6,10H,1,7-9H2,2H3 |
| InChIKey | VYUVHAZMIAGHOQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |